C5H13N3S — CID 142741769
2-(5-methyl-1,2,5-thiadiazolidin-2-yl)ethanamine (PubChem CID 142741769) has the molecular formula C5H13N3S and a molecular weight of 147.25 g/mol. Its IUPAC name is 2-(5-methyl-1,2,5-thiadiazolidin-2-yl)ethanamine.
| Compound Name | 2-(5-methyl-1,2,5-thiadiazolidin-2-yl)ethanamine |
|---|---|
| PubChem CID | 142741769 |
| Molecular Formula | C5H13N3S |
| Molecular Weight | 147.25 g/mol |
| Exact Mass | 147.08 |
| IUPAC Name | 2-(5-methyl-1,2,5-thiadiazolidin-2-yl)ethanamine |
| SMILES | CN1CCN(CCN)S1 |
| InChI | InChI=1S/C5H13N3S/c1-7-4-5-8(9-7)3-2-6/h2-6H2,1H3 |
| InChIKey | NAEUPWCOHUTUBZ-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.25 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|