About N,N-dimethylpyrido[1,2-a]benzimidazol-3-amine
N,N-dimethylpyrido[1,2-a]benzimidazol-3-amine (PubChem CID 142743723) has the molecular formula C13H13N3
and a molecular weight of 211.27 g/mol. Its IUPAC name is N,N-dimethylpyrido[1,2-a]benzimidazol-3-amine.
Molecular Properties
| Compound Name | N,N-dimethylpyrido[1,2-a]benzimidazol-3-amine |
| PubChem CID | 142743723 |
| Molecular Formula | C13H13N3 |
| Molecular Weight | 211.27 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | N,N-dimethylpyrido[1,2-a]benzimidazol-3-amine |
| SMILES | CN(C)c1ccn2c(c1)nc1ccccc12 |
| InChI | InChI=1S/C13H13N3/c1-15(2)10-7-8-16-12-6-4-3-5-11(12)14-13(16)9-10/h3-9H,1-2H3 |
| InChIKey | BVIAYCZMMFXUKD-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 20.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.27 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N,N-dimethylpyrido[1,2-a]benzimidazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylpyrido[1,2-a]benzimidazol-3-amine?
The IUPAC name of N,N-dimethylpyrido[1,2-a]benzimidazol-3-amine (CID 142743723) is N,N-dimethylpyrido[1,2-a]benzimidazol-3-amine.
What is the SMILES notation for N,N-dimethylpyrido[1,2-a]benzimidazol-3-amine?
The canonical SMILES for N,N-dimethylpyrido[1,2-a]benzimidazol-3-amine is CN(C)c1ccn2c(c1)nc1ccccc12.
What is the InChIKey of N,N-dimethylpyrido[1,2-a]benzimidazol-3-amine?
The InChIKey is BVIAYCZMMFXUKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13N3/c1-15(2)10-7-8-16-12-6-4-3-5-11(12)14-13(16)9-10/h3-9H,1-2H3.
What are the key properties of N,N-dimethylpyrido[1,2-a]benzimidazol-3-amine?
N,N-dimethylpyrido[1,2-a]benzimidazol-3-amine has a molecular weight of 211.27 g/mol, XLogP of 2.55, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylpyrido[1,2-a]benzimidazol-3-amine is sourced from PubChem (CID 142743723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).