C29H41NO3 — CID 142745632
1-(7-phenylheptyl)-4-undec-10-enoylpyrrole-2-carboxylic acid (PubChem CID 142745632) has the molecular formula C29H41NO3 and a molecular weight of 451.65 g/mol. Its IUPAC name is 1-(7-phenylheptyl)-4-undec-10-enoylpyrrole-2-carboxylic acid.
| Compound Name | 1-(7-phenylheptyl)-4-undec-10-enoylpyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 142745632 |
| Molecular Formula | C29H41NO3 |
| Molecular Weight | 451.65 g/mol |
| Exact Mass | 451.31 |
| IUPAC Name | 1-(7-phenylheptyl)-4-undec-10-enoylpyrrole-2-carboxylic acid |
| SMILES | C=CCCCCCCCCC(=O)c1cc(C(=O)O)n(CCCCCCCc2ccccc2)c1 |
| InChI | InChI=1S/C29H41NO3/c1-2-3-4-5-6-7-10-16-21-28(31)26-23-27(29(32)33)30(24-26)22-17-11-8-9-13-18-25-19-14-12-15-20-25/h2,12,14-15,19-20,23-24H,1,3-11,13,16-18,21-22H2,(H,32,33) |
| InChIKey | UNQWJKJXSKVDOH-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.65 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|