C26H35NO3 — CID 142745638
1-(4-phenylbutyl)-4-undec-10-enoylpyrrole-2-carboxylic acid (PubChem CID 142745638) has the molecular formula C26H35NO3 and a molecular weight of 409.57 g/mol. Its IUPAC name is 1-(4-phenylbutyl)-4-undec-10-enoylpyrrole-2-carboxylic acid.
| Compound Name | 1-(4-phenylbutyl)-4-undec-10-enoylpyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 142745638 |
| Molecular Formula | C26H35NO3 |
| Molecular Weight | 409.57 g/mol |
| Exact Mass | 409.26 |
| IUPAC Name | 1-(4-phenylbutyl)-4-undec-10-enoylpyrrole-2-carboxylic acid |
| SMILES | C=CCCCCCCCCC(=O)c1cc(C(=O)O)n(CCCCc2ccccc2)c1 |
| InChI | InChI=1S/C26H35NO3/c1-2-3-4-5-6-7-8-12-18-25(28)23-20-24(26(29)30)27(21-23)19-14-13-17-22-15-10-9-11-16-22/h2,9-11,15-16,20-21H,1,3-8,12-14,17-19H2,(H,29,30) |
| InChIKey | AQDIKPDTGTYLAT-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.57 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|