C13H9N5O3S — CID 142748603
(5Z)-5-[[1-(4-nitrophenyl)pyrazol-4-yl]methylidene]-2-sulfanylideneimidazolidin-4-one (PubChem CID 142748603) has the molecular formula C13H9N5O3S and a molecular weight of 315.31 g/mol. Its IUPAC name is (5Z)-5-[[1-(4-nitrophenyl)pyrazol-4-yl]methylidene]-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5Z)-5-[[1-(4-nitrophenyl)pyrazol-4-yl]methylidene]-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 142748603 |
| Molecular Formula | C13H9N5O3S |
| Molecular Weight | 315.31 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | (5Z)-5-[[1-(4-nitrophenyl)pyrazol-4-yl]methylidene]-2-sulfanylideneimidazolidin-4-one |
| SMILES | O=C1NC(=S)N/C1=C\c1cnn(-c2ccc([N+](=O)[O-])cc2)c1 |
| InChI | InChI=1S/C13H9N5O3S/c19-12-11(15-13(22)16-12)5-8-6-14-17(7-8)9-1-3-10(4-2-9)18(20)21/h1-7H,(H2,15,16,19,22)/b11-5- |
| InChIKey | XYYJBJUOMMLTEA-WZUFQYTHSA-N |
| XLogP | 1.13 |
| TPSA | 102.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.31 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|