C22H26O5S3 — CID 142750038
O-ethyl [6-(benzenesulfonyl)-5-oxo-1-phenylmethoxyhexan-2-yl]sulfanylmethanethioate (PubChem CID 142750038) has the molecular formula C22H26O5S3 and a molecular weight of 466.65 g/mol. Its IUPAC name is O-ethyl [6-(benzenesulfonyl)-5-oxo-1-phenylmethoxyhexan-2-yl]sulfanylmethanethioate.
| Compound Name | O-ethyl [6-(benzenesulfonyl)-5-oxo-1-phenylmethoxyhexan-2-yl]sulfanylmethanethioate |
|---|---|
| PubChem CID | 142750038 |
| Molecular Formula | C22H26O5S3 |
| Molecular Weight | 466.65 g/mol |
| Exact Mass | 466.09 |
| IUPAC Name | O-ethyl [6-(benzenesulfonyl)-5-oxo-1-phenylmethoxyhexan-2-yl]sulfanylmethanethioate |
| SMILES | CCOC(=S)SC(CCC(=O)CS(=O)(=O)c1ccccc1)COCc1ccccc1 |
| InChI | InChI=1S/C22H26O5S3/c1-2-27-22(28)29-20(16-26-15-18-9-5-3-6-10-18)14-13-19(23)17-30(24,25)21-11-7-4-8-12-21/h3-12,20H,2,13-17H2,1H3 |
| InChIKey | PIMHHGKXFCRPLW-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.65 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|