C20H13B — CID 142752542
3-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-1(21),2(7),3,5,9,11,13,15,17,19-decaene (PubChem CID 142752542) has the molecular formula C20H13B and a molecular weight of 264.14 g/mol. Its IUPAC name is 3-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-1(21),2(7),3,5,9,11,13,15,17,19-decaene.
| Compound Name | 3-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-1(21),2(7),3,5,9,11,13,15,17,19-decaene |
|---|---|
| PubChem CID | 142752542 |
| Molecular Formula | C20H13B |
| Molecular Weight | 264.14 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 3-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-1(21),2(7),3,5,9,11,13,15,17,19-decaene |
| SMILES | b1cccc2c1-c1c3ccccc3cc3cccc(c13)C2 |
| InChI | InChI=1S/C20H13B/c1-2-9-17-13(5-1)11-14-6-3-7-15-12-16-8-4-10-21-20(16)19(17)18(14)15/h1-11H,12H2 |
| InChIKey | GMKWPHLUDMASMV-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.14 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|