C22H25FN2O — CID 142759079
6-fluoro-5-[2-(4-methoxyphenyl)ethyl]-1,2-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indole (PubChem CID 142759079) has the molecular formula C22H25FN2O and a molecular weight of 352.45 g/mol. Its IUPAC name is 6-fluoro-5-[2-(4-methoxyphenyl)ethyl]-1,2-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indole.
| Compound Name | 6-fluoro-5-[2-(4-methoxyphenyl)ethyl]-1,2-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indole |
|---|---|
| PubChem CID | 142759079 |
| Molecular Formula | C22H25FN2O |
| Molecular Weight | 352.45 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | 6-fluoro-5-[2-(4-methoxyphenyl)ethyl]-1,2-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indole |
| SMILES | COc1ccc(CCn2c3c(c4cccc(F)c42)C(C)N(C)CC3)cc1 |
| InChI | InChI=1S/C22H25FN2O/c1-15-21-18-5-4-6-19(23)22(18)25(20(21)12-13-24(15)2)14-11-16-7-9-17(26-3)10-8-16/h4-10,15H,11-14H2,1-3H3 |
| InChIKey | WIBOWDISHIYOHY-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 17.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.45 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|