C20H19FO6 — CID 142759682
4-(4-fluorophenyl)-2,4-dihydroxy-5-phenyl-2-propan-2-yl-3,6-dioxabicyclo[3.1.0]hexane-1-carboxylic acid (PubChem CID 142759682) has the molecular formula C20H19FO6 and a molecular weight of 374.36 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-2,4-dihydroxy-5-phenyl-2-propan-2-yl-3,6-dioxabicyclo[3.1.0]hexane-1-carboxylic acid.
| Compound Name | 4-(4-fluorophenyl)-2,4-dihydroxy-5-phenyl-2-propan-2-yl-3,6-dioxabicyclo[3.1.0]hexane-1-carboxylic acid |
|---|---|
| PubChem CID | 142759682 |
| Molecular Formula | C20H19FO6 |
| Molecular Weight | 374.36 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | 4-(4-fluorophenyl)-2,4-dihydroxy-5-phenyl-2-propan-2-yl-3,6-dioxabicyclo[3.1.0]hexane-1-carboxylic acid |
| SMILES | CC(C)C1(O)OC(O)(c2ccc(F)cc2)C2(c3ccccc3)OC12C(=O)O |
| InChI | InChI=1S/C20H19FO6/c1-12(2)19(24)18(16(22)23)17(26-18,13-6-4-3-5-7-13)20(25,27-19)14-8-10-15(21)11-9-14/h3-12,24-25H,1-2H3,(H,22,23) |
| InChIKey | XFRZMANQRAYCIM-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.36 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|