C26H24FNO5 — CID 98051843
(1R,2R,4R,5R)-4-(4-fluorophenyl)-2,4-dihydroxy-N,5-diphenyl-2-propan-2-yl-3,6-dioxabicyclo[3.1.0]hexane-1-carboxamide (PubChem CID 98051843) has the molecular formula C26H24FNO5 and a molecular weight of 449.48 g/mol. Its IUPAC name is (1R,2R,4R,5R)-4-(4-fluorophenyl)-2,4-dihydroxy-N,5-diphenyl-2-propan-2-yl-3,6-dioxabicyclo[3.1.0]hexane-1-carboxamide.
| Compound Name | (1R,2R,4R,5R)-4-(4-fluorophenyl)-2,4-dihydroxy-N,5-diphenyl-2-propan-2-yl-3,6-dioxabicyclo[3.1.0]hexane-1-carboxamide |
|---|---|
| PubChem CID | 98051843 |
| Molecular Formula | C26H24FNO5 |
| Molecular Weight | 449.48 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | (1R,2R,4R,5R)-4-(4-fluorophenyl)-2,4-dihydroxy-N,5-diphenyl-2-propan-2-yl-3,6-dioxabicyclo[3.1.0]hexane-1-carboxamide |
| SMILES | CC(C)[C@@]1(O)O[C@](O)(c2ccc(F)cc2)[C@]2(c3ccccc3)O[C@]21C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C26H24FNO5/c1-17(2)25(30)24(22(29)28-21-11-7-4-8-12-21)23(32-24,18-9-5-3-6-10-18)26(31,33-25)19-13-15-20(27)16-14-19/h3-17,30-31H,1-2H3,(H,28,29)/t23-,24-,25-,26-/m1/s1 |
| InChIKey | NNEBPPHOMFPLDK-VEYUFSJPSA-N |
| XLogP | 3.65 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.48 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|