C24H27NO4 — CID 142760526
2-[(5-tert-butylfuran-2-yl)methyl]-4,5-dimethoxy-N-phenylbenzamide (PubChem CID 142760526) has the molecular formula C24H27NO4 and a molecular weight of 393.48 g/mol. Its IUPAC name is 2-[(5-tert-butylfuran-2-yl)methyl]-4,5-dimethoxy-N-phenylbenzamide.
| Compound Name | 2-[(5-tert-butylfuran-2-yl)methyl]-4,5-dimethoxy-N-phenylbenzamide |
|---|---|
| PubChem CID | 142760526 |
| Molecular Formula | C24H27NO4 |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | 2-[(5-tert-butylfuran-2-yl)methyl]-4,5-dimethoxy-N-phenylbenzamide |
| SMILES | COc1cc(Cc2ccc(C(C)(C)C)o2)c(C(=O)Nc2ccccc2)cc1OC |
| InChI | InChI=1S/C24H27NO4/c1-24(2,3)22-12-11-18(29-22)13-16-14-20(27-4)21(28-5)15-19(16)23(26)25-17-9-7-6-8-10-17/h6-12,14-15H,13H2,1-5H3,(H,25,26) |
| InChIKey | IAOQHILDOMHHMN-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |