C19H20N4O3S — CID 142760939
1-[5-(dibenzylamino)-1,2,4-thiadiazol-3-yl]propan-2-yl nitrate (PubChem CID 142760939) has the molecular formula C19H20N4O3S and a molecular weight of 384.46 g/mol. Its IUPAC name is 1-[5-(dibenzylamino)-1,2,4-thiadiazol-3-yl]propan-2-yl nitrate.
| Compound Name | 1-[5-(dibenzylamino)-1,2,4-thiadiazol-3-yl]propan-2-yl nitrate |
|---|---|
| PubChem CID | 142760939 |
| Molecular Formula | C19H20N4O3S |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | 1-[5-(dibenzylamino)-1,2,4-thiadiazol-3-yl]propan-2-yl nitrate |
| SMILES | CC(Cc1nsc(N(Cc2ccccc2)Cc2ccccc2)n1)O[N+](=O)[O-] |
| InChI | InChI=1S/C19H20N4O3S/c1-15(26-23(24)25)12-18-20-19(27-21-18)22(13-16-8-4-2-5-9-16)14-17-10-6-3-7-11-17/h2-11,15H,12-14H2,1H3 |
| InChIKey | GVXUSWFJRRHKFR-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 81.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|