About 1-[5-(dibenzylamino)-1,2,4-thiadiazol-3-yl]propan-2-yl nitrate
1-[5-(dibenzylamino)-1,2,4-thiadiazol-3-yl]propan-2-yl nitrate (PubChem CID 142760939) has the molecular formula C19H20N4O3S
and a molecular weight of 384.46 g/mol. Its IUPAC name is 1-[5-(dibenzylamino)-1,2,4-thiadiazol-3-yl]propan-2-yl nitrate.
Molecular Properties
| Compound Name | 1-[5-(dibenzylamino)-1,2,4-thiadiazol-3-yl]propan-2-yl nitrate |
| PubChem CID | 142760939 |
| Molecular Formula | C19H20N4O3S |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | 1-[5-(dibenzylamino)-1,2,4-thiadiazol-3-yl]propan-2-yl nitrate |
| SMILES | CC(Cc1nsc(N(Cc2ccccc2)Cc2ccccc2)n1)O[N+](=O)[O-] |
| InChI | InChI=1S/C19H20N4O3S/c1-15(26-23(24)25)12-18-20-19(27-21-18)22(13-16-8-4-2-5-9-16)14-17-10-6-3-7-11-17/h2-11,15H,12-14H2,1H3 |
| InChIKey | GVXUSWFJRRHKFR-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 81.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[5-(dibenzylamino)-1,2,4-thiadiazol-3-yl]propan-2-yl nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-(dibenzylamino)-1,2,4-thiadiazol-3-yl]propan-2-yl nitrate?
The IUPAC name of 1-[5-(dibenzylamino)-1,2,4-thiadiazol-3-yl]propan-2-yl nitrate (CID 142760939) is 1-[5-(dibenzylamino)-1,2,4-thiadiazol-3-yl]propan-2-yl nitrate.
What is the SMILES notation for 1-[5-(dibenzylamino)-1,2,4-thiadiazol-3-yl]propan-2-yl nitrate?
The canonical SMILES for 1-[5-(dibenzylamino)-1,2,4-thiadiazol-3-yl]propan-2-yl nitrate is CC(Cc1nsc(N(Cc2ccccc2)Cc2ccccc2)n1)O[N+](=O)[O-].
What is the InChIKey of 1-[5-(dibenzylamino)-1,2,4-thiadiazol-3-yl]propan-2-yl nitrate?
The InChIKey is GVXUSWFJRRHKFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N4O3S/c1-15(26-23(24)25)12-18-20-19(27-21-18)22(13-16-8-4-2-5-9-16)14-17-10-6-3-7-11-17/h2-11,15H,12-14H2,1H3.
What are the key properties of 1-[5-(dibenzylamino)-1,2,4-thiadiazol-3-yl]propan-2-yl nitrate?
1-[5-(dibenzylamino)-1,2,4-thiadiazol-3-yl]propan-2-yl nitrate has a molecular weight of 384.46 g/mol, XLogP of 3.88, 9 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-(dibenzylamino)-1,2,4-thiadiazol-3-yl]propan-2-yl nitrate is sourced from PubChem (CID 142760939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).