C20H36N2 — CID 142761180
1-(10-piperidin-1-yldeca-2,8-dienyl)piperidine (PubChem CID 142761180) has the molecular formula C20H36N2 and a molecular weight of 304.52 g/mol. Its IUPAC name is 1-(10-piperidin-1-yldeca-2,8-dienyl)piperidine.
| Compound Name | 1-(10-piperidin-1-yldeca-2,8-dienyl)piperidine |
|---|---|
| PubChem CID | 142761180 |
| Molecular Formula | C20H36N2 |
| Molecular Weight | 304.52 g/mol |
| Exact Mass | 304.29 |
| IUPAC Name | 1-(10-piperidin-1-yldeca-2,8-dienyl)piperidine |
| SMILES | C(=CCN1CCCCC1)CCCCC=CCN1CCCCC1 |
| InChI | InChI=1S/C20H36N2/c1(3-5-9-15-21-17-11-7-12-18-21)2-4-6-10-16-22-19-13-8-14-20-22/h5-6,9-10H,1-4,7-8,11-20H2 |
| InChIKey | FVRAUMJWRDWJCC-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.52 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|