C16H34N2 — CID 143070826
ethane;2-ethyl-1-methylpiperidine;1-methyl-3,6-dihydro-2H-pyridine (PubChem CID 143070826) has the molecular formula C16H34N2 and a molecular weight of 254.46 g/mol. Its IUPAC name is ethane;2-ethyl-1-methylpiperidine;1-methyl-3,6-dihydro-2H-pyridine.
| Compound Name | ethane;2-ethyl-1-methylpiperidine;1-methyl-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 143070826 |
| Molecular Formula | C16H34N2 |
| Molecular Weight | 254.46 g/mol |
| Exact Mass | 254.27 |
| IUPAC Name | ethane;2-ethyl-1-methylpiperidine;1-methyl-3,6-dihydro-2H-pyridine |
| SMILES | CC.CCC1CCCCN1C.CN1CC=CCC1 |
| InChI | InChI=1S/C8H17N.C6H11N.C2H6/c1-3-8-6-4-5-7-9(8)2;1-7-5-3-2-4-6-7;1-2/h8H,3-7H2,1-2H3;2-3H,4-6H2,1H3;1-2H3 |
| InChIKey | LRABYLKKJVQOIL-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.46 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|