C12H15F3O2S — CID 142762495
1-ethynyl-4-(4,4,4-trifluorobutylsulfonyl)cyclohexene (PubChem CID 142762495) has the molecular formula C12H15F3O2S and a molecular weight of 280.31 g/mol. Its IUPAC name is 1-ethynyl-4-(4,4,4-trifluorobutylsulfonyl)cyclohexene.
| Compound Name | 1-ethynyl-4-(4,4,4-trifluorobutylsulfonyl)cyclohexene |
|---|---|
| PubChem CID | 142762495 |
| Molecular Formula | C12H15F3O2S |
| Molecular Weight | 280.31 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | 1-ethynyl-4-(4,4,4-trifluorobutylsulfonyl)cyclohexene |
| SMILES | C#CC1=CCC(S(=O)(=O)CCCC(F)(F)F)CC1 |
| InChI | InChI=1S/C12H15F3O2S/c1-2-10-4-6-11(7-5-10)18(16,17)9-3-8-12(13,14)15/h1,4,11H,3,5-9H2 |
| InChIKey | NZXOWPOYFIPBFD-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.31 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|