C12H12F3O2S- — CID 91454915
1-(4-ethynylcyclohex-3-en-1-ylidene)-4,4,4-trifluorobutane-1-sulfinate (PubChem CID 91454915) has the molecular formula C12H12F3O2S- and a molecular weight of 277.29 g/mol. Its IUPAC name is 1-(4-ethynylcyclohex-3-en-1-ylidene)-4,4,4-trifluorobutane-1-sulfinate.
| Compound Name | 1-(4-ethynylcyclohex-3-en-1-ylidene)-4,4,4-trifluorobutane-1-sulfinate |
|---|---|
| PubChem CID | 91454915 |
| Molecular Formula | C12H12F3O2S- |
| Molecular Weight | 277.29 g/mol |
| Exact Mass | 277.05 |
| IUPAC Name | 1-(4-ethynylcyclohex-3-en-1-ylidene)-4,4,4-trifluorobutane-1-sulfinate |
| SMILES | C#CC1=CCC(=C(CCC(F)(F)F)S(=O)[O-])CC1 |
| InChI | InChI=1S/C12H13F3O2S/c1-2-9-3-5-10(6-4-9)11(18(16)17)7-8-12(13,14)15/h1,3H,4-8H2,(H,16,17)/p-1 |
| InChIKey | QSRWPEZVSZTOBH-UHFFFAOYSA-M |
| XLogP | 3.21 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.29 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|