C12H13F3O2S — CID 91454916
1-(4-ethynylcyclohex-3-en-1-ylidene)-4,4,4-trifluorobutane-1-sulfinic acid (PubChem CID 91454916) has the molecular formula C12H13F3O2S and a molecular weight of 278.29 g/mol. Its IUPAC name is 1-(4-ethynylcyclohex-3-en-1-ylidene)-4,4,4-trifluorobutane-1-sulfinic acid.
| Compound Name | 1-(4-ethynylcyclohex-3-en-1-ylidene)-4,4,4-trifluorobutane-1-sulfinic acid |
|---|---|
| PubChem CID | 91454916 |
| Molecular Formula | C12H13F3O2S |
| Molecular Weight | 278.29 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | 1-(4-ethynylcyclohex-3-en-1-ylidene)-4,4,4-trifluorobutane-1-sulfinic acid |
| SMILES | C#CC1=CCC(=C(CCC(F)(F)F)S(=O)O)CC1 |
| InChI | InChI=1S/C12H13F3O2S/c1-2-9-3-5-10(6-4-9)11(18(16)17)7-8-12(13,14)15/h1,3H,4-8H2,(H,16,17) |
| InChIKey | QSRWPEZVSZTOBH-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.29 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|