C14H11F3N2 — CID 142765912
2,4-dimethyl-7-(trifluoromethyl)pyrido[1,2-a]benzimidazole (PubChem CID 142765912) has the molecular formula C14H11F3N2 and a molecular weight of 264.25 g/mol. Its IUPAC name is 2,4-dimethyl-7-(trifluoromethyl)pyrido[1,2-a]benzimidazole.
| Compound Name | 2,4-dimethyl-7-(trifluoromethyl)pyrido[1,2-a]benzimidazole |
|---|---|
| PubChem CID | 142765912 |
| Molecular Formula | C14H11F3N2 |
| Molecular Weight | 264.25 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 2,4-dimethyl-7-(trifluoromethyl)pyrido[1,2-a]benzimidazole |
| SMILES | Cc1cc(C)c2nc3cc(C(F)(F)F)ccc3n2c1 |
| InChI | InChI=1S/C14H11F3N2/c1-8-5-9(2)13-18-11-6-10(14(15,16)17)3-4-12(11)19(13)7-8/h3-7H,1-2H3 |
| InChIKey | SSNQFEPAGWFSMD-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.25 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |