C9H15N3O2S — CID 142767791
9a-amino-2-methylsulfanyl-6,7,8,9-tetrahydro-4H-pyrido[1,2-a]pyrazine-1,3-dione (PubChem CID 142767791) has the molecular formula C9H15N3O2S and a molecular weight of 229.30 g/mol. Its IUPAC name is 9a-amino-2-methylsulfanyl-6,7,8,9-tetrahydro-4H-pyrido[1,2-a]pyrazine-1,3-dione.
| Compound Name | 9a-amino-2-methylsulfanyl-6,7,8,9-tetrahydro-4H-pyrido[1,2-a]pyrazine-1,3-dione |
|---|---|
| PubChem CID | 142767791 |
| Molecular Formula | C9H15N3O2S |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 9a-amino-2-methylsulfanyl-6,7,8,9-tetrahydro-4H-pyrido[1,2-a]pyrazine-1,3-dione |
| SMILES | CSN1C(=O)CN2CCCCC2(N)C1=O |
| InChI | InChI=1S/C9H15N3O2S/c1-15-12-7(13)6-11-5-3-2-4-9(11,10)8(12)14/h2-6,10H2,1H3 |
| InChIKey | BOFNFWQBUKWDFU-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|