C8H10N2O4 — CID 142768028
2-(5-methyl-2,4-dioxo-1H-pyrimidin-3-yl)propanoic acid (PubChem CID 142768028) has the molecular formula C8H10N2O4 and a molecular weight of 198.18 g/mol. Its IUPAC name is 2-(5-methyl-2,4-dioxo-1H-pyrimidin-3-yl)propanoic acid.
| Compound Name | 2-(5-methyl-2,4-dioxo-1H-pyrimidin-3-yl)propanoic acid |
|---|---|
| PubChem CID | 142768028 |
| Molecular Formula | C8H10N2O4 |
| Molecular Weight | 198.18 g/mol |
| Exact Mass | 198.06 |
| IUPAC Name | 2-(5-methyl-2,4-dioxo-1H-pyrimidin-3-yl)propanoic acid |
| SMILES | Cc1c[nH]c(=O)n(C(C)C(=O)O)c1=O |
| InChI | InChI=1S/C8H10N2O4/c1-4-3-9-8(14)10(6(4)11)5(2)7(12)13/h3,5H,1-2H3,(H,9,14)(H,12,13) |
| InChIKey | HZOBAYIABRXSET-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 92.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.18 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |