About 3-iodoprop-2-ynyl N-(2-fluorophenyl)carbamate
3-iodoprop-2-ynyl N-(2-fluorophenyl)carbamate (PubChem CID 14276839) has the molecular formula C10H7FINO2
and a molecular weight of 319.07 g/mol. Its IUPAC name is 3-iodoprop-2-ynyl N-(2-fluorophenyl)carbamate.
Molecular Properties
| Compound Name | 3-iodoprop-2-ynyl N-(2-fluorophenyl)carbamate |
| PubChem CID | 14276839 |
| Molecular Formula | C10H7FINO2 |
| Molecular Weight | 319.07 g/mol |
| Exact Mass | 318.95 |
| IUPAC Name | 3-iodoprop-2-ynyl N-(2-fluorophenyl)carbamate |
| SMILES | O=C(Nc1ccccc1F)OCC#CI |
| InChI | InChI=1S/C10H7FINO2/c11-8-4-1-2-5-9(8)13-10(14)15-7-3-6-12/h1-2,4-5H,7H2,(H,13,14) |
| InChIKey | ONWCQABSBISYRC-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.07 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-iodoprop-2-ynyl N-(2-fluorophenyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-iodoprop-2-ynyl N-(2-fluorophenyl)carbamate?
The IUPAC name of 3-iodoprop-2-ynyl N-(2-fluorophenyl)carbamate (CID 14276839) is 3-iodoprop-2-ynyl N-(2-fluorophenyl)carbamate.
What is the SMILES notation for 3-iodoprop-2-ynyl N-(2-fluorophenyl)carbamate?
The canonical SMILES for 3-iodoprop-2-ynyl N-(2-fluorophenyl)carbamate is O=C(Nc1ccccc1F)OCC#CI.
What is the InChIKey of 3-iodoprop-2-ynyl N-(2-fluorophenyl)carbamate?
The InChIKey is ONWCQABSBISYRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7FINO2/c11-8-4-1-2-5-9(8)13-10(14)15-7-3-6-12/h1-2,4-5H,7H2,(H,13,14).
What are the key properties of 3-iodoprop-2-ynyl N-(2-fluorophenyl)carbamate?
3-iodoprop-2-ynyl N-(2-fluorophenyl)carbamate has a molecular weight of 319.07 g/mol, XLogP of 2.77, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-iodoprop-2-ynyl N-(2-fluorophenyl)carbamate is sourced from PubChem (CID 14276839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).