C20H21BrClN3O2 — CID 142769252
2-(4-bromoanilino)-4-phenyl-1-piperazin-1-ylbut-2-ene-1,4-dione;hydrochloride (PubChem CID 142769252) has the molecular formula C20H21BrClN3O2 and a molecular weight of 450.76 g/mol. Its IUPAC name is 2-(4-bromoanilino)-4-phenyl-1-piperazin-1-ylbut-2-ene-1,4-dione;hydrochloride.
| Compound Name | 2-(4-bromoanilino)-4-phenyl-1-piperazin-1-ylbut-2-ene-1,4-dione;hydrochloride |
|---|---|
| PubChem CID | 142769252 |
| Molecular Formula | C20H21BrClN3O2 |
| Molecular Weight | 450.76 g/mol |
| Exact Mass | 449.05 |
| IUPAC Name | 2-(4-bromoanilino)-4-phenyl-1-piperazin-1-ylbut-2-ene-1,4-dione;hydrochloride |
| SMILES | Cl.O=C(C=C(Nc1ccc(Br)cc1)C(=O)N1CCNCC1)c1ccccc1 |
| InChI | InChI=1S/C20H20BrN3O2.ClH/c21-16-6-8-17(9-7-16)23-18(20(26)24-12-10-22-11-13-24)14-19(25)15-4-2-1-3-5-15;/h1-9,14,22-23H,10-13H2;1H |
| InChIKey | AQYOXCJEXQSSLT-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.76 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|