C12H8F3N3O — CID 142769489
6-methoxy-4-(trifluoromethyl)-9H-pyrimido[4,5-b]indole (PubChem CID 142769489) has the molecular formula C12H8F3N3O and a molecular weight of 267.21 g/mol. Its IUPAC name is 6-methoxy-4-(trifluoromethyl)-9H-pyrimido[4,5-b]indole.
| Compound Name | 6-methoxy-4-(trifluoromethyl)-9H-pyrimido[4,5-b]indole |
|---|---|
| PubChem CID | 142769489 |
| Molecular Formula | C12H8F3N3O |
| Molecular Weight | 267.21 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | 6-methoxy-4-(trifluoromethyl)-9H-pyrimido[4,5-b]indole |
| SMILES | COc1ccc2[nH]c3ncnc(C(F)(F)F)c3c2c1 |
| InChI | InChI=1S/C12H8F3N3O/c1-19-6-2-3-8-7(4-6)9-10(12(13,14)15)16-5-17-11(9)18-8/h2-5H,1H3,(H,16,17,18) |
| InChIKey | DDAIRDFYMTXQGK-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.21 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |