C22H18FN5O — CID 142770564
3-[(4-fluorophenyl)methylamino]-N-phenyl-1-pyridin-2-ylpyrazole-4-carboxamide (PubChem CID 142770564) has the molecular formula C22H18FN5O and a molecular weight of 387.42 g/mol. Its IUPAC name is 3-[(4-fluorophenyl)methylamino]-N-phenyl-1-pyridin-2-ylpyrazole-4-carboxamide.
| Compound Name | 3-[(4-fluorophenyl)methylamino]-N-phenyl-1-pyridin-2-ylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 142770564 |
| Molecular Formula | C22H18FN5O |
| Molecular Weight | 387.42 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | 3-[(4-fluorophenyl)methylamino]-N-phenyl-1-pyridin-2-ylpyrazole-4-carboxamide |
| SMILES | O=C(Nc1ccccc1)c1cn(-c2ccccn2)nc1NCc1ccc(F)cc1 |
| InChI | InChI=1S/C22H18FN5O/c23-17-11-9-16(10-12-17)14-25-21-19(22(29)26-18-6-2-1-3-7-18)15-28(27-21)20-8-4-5-13-24-20/h1-13,15H,14H2,(H,25,27)(H,26,29) |
| InChIKey | WEIXNMHRJSNHHG-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.42 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |