C21H18N6O — CID 142770586
(2-aminophenyl)-[5-(benzylamino)-3-pyridin-2-yl-1,2,4-triazol-1-yl]methanone (PubChem CID 142770586) has the molecular formula C21H18N6O and a molecular weight of 370.42 g/mol. Its IUPAC name is (2-aminophenyl)-[5-(benzylamino)-3-pyridin-2-yl-1,2,4-triazol-1-yl]methanone.
| Compound Name | (2-aminophenyl)-[5-(benzylamino)-3-pyridin-2-yl-1,2,4-triazol-1-yl]methanone |
|---|---|
| PubChem CID | 142770586 |
| Molecular Formula | C21H18N6O |
| Molecular Weight | 370.42 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | (2-aminophenyl)-[5-(benzylamino)-3-pyridin-2-yl-1,2,4-triazol-1-yl]methanone |
| SMILES | Nc1ccccc1C(=O)n1nc(-c2ccccn2)nc1NCc1ccccc1 |
| InChI | InChI=1S/C21H18N6O/c22-17-11-5-4-10-16(17)20(28)27-21(24-14-15-8-2-1-3-9-15)25-19(26-27)18-12-6-7-13-23-18/h1-13H,14,22H2,(H,24,25,26) |
| InChIKey | LLFYLFZLNGKXKB-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.42 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|