C19H23BN2O5 — CID 142771954
[(1R)-1-[[2-[benzoyl(ethyl)amino]acetyl]amino]-2-phenylethoxy]boronic acid (PubChem CID 142771954) has the molecular formula C19H23BN2O5 and a molecular weight of 370.21 g/mol. Its IUPAC name is [(1R)-1-[[2-[benzoyl(ethyl)amino]acetyl]amino]-2-phenylethoxy]boronic acid.
| Compound Name | [(1R)-1-[[2-[benzoyl(ethyl)amino]acetyl]amino]-2-phenylethoxy]boronic acid |
|---|---|
| PubChem CID | 142771954 |
| Molecular Formula | C19H23BN2O5 |
| Molecular Weight | 370.21 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | [(1R)-1-[[2-[benzoyl(ethyl)amino]acetyl]amino]-2-phenylethoxy]boronic acid |
| SMILES | CCN(CC(=O)N[C@@H](Cc1ccccc1)OB(O)O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C19H23BN2O5/c1-2-22(19(24)16-11-7-4-8-12-16)14-17(23)21-18(27-20(25)26)13-15-9-5-3-6-10-15/h3-12,18,25-26H,2,13-14H2,1H3,(H,21,23)/t18-/m1/s1 |
| InChIKey | PTEVRBMBMVAOHD-GOSISDBHSA-N |
| XLogP | 0.82 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.21 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|