C25H24F3N5S — CID 142772360
N-[[2-ethyl-6-(1,2,3,6-tetrahydropyridin-4-yl)imidazo[1,2-a]pyridin-3-yl]methyl]-4-[4-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine (PubChem CID 142772360) has the molecular formula C25H24F3N5S and a molecular weight of 483.56 g/mol. Its IUPAC name is N-[[2-ethyl-6-(1,2,3,6-tetrahydropyridin-4-yl)imidazo[1,2-a]pyridin-3-yl]methyl]-4-[4-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine.
| Compound Name | N-[[2-ethyl-6-(1,2,3,6-tetrahydropyridin-4-yl)imidazo[1,2-a]pyridin-3-yl]methyl]-4-[4-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 142772360 |
| Molecular Formula | C25H24F3N5S |
| Molecular Weight | 483.56 g/mol |
| Exact Mass | 483.17 |
| IUPAC Name | N-[[2-ethyl-6-(1,2,3,6-tetrahydropyridin-4-yl)imidazo[1,2-a]pyridin-3-yl]methyl]-4-[4-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine |
| SMILES | CCc1nc2ccc(C3=CCNCC3)cn2c1CNc1nc(-c2ccc(C(F)(F)F)cc2)cs1 |
| InChI | InChI=1S/C25H24F3N5S/c1-2-20-22(33-14-18(5-8-23(33)31-20)16-9-11-29-12-10-16)13-30-24-32-21(15-34-24)17-3-6-19(7-4-17)25(26,27)28/h3-9,14-15,29H,2,10-13H2,1H3,(H,30,32) |
| InChIKey | ZATHFGFZNABUCI-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 54.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.56 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |