C10H20N2O2 — CID 142774145
[(E)-2,5,5-trimethylhex-3-en-2-yl] N-aminocarbamate (PubChem CID 142774145) has the molecular formula C10H20N2O2 and a molecular weight of 200.28 g/mol. Its IUPAC name is [(E)-2,5,5-trimethylhex-3-en-2-yl] N-aminocarbamate.
| Compound Name | [(E)-2,5,5-trimethylhex-3-en-2-yl] N-aminocarbamate |
|---|---|
| PubChem CID | 142774145 |
| Molecular Formula | C10H20N2O2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.15 |
| IUPAC Name | [(E)-2,5,5-trimethylhex-3-en-2-yl] N-aminocarbamate |
| SMILES | CC(C)(C)/C=C/C(C)(C)OC(=O)NN |
| InChI | InChI=1S/C10H20N2O2/c1-9(2,3)6-7-10(4,5)14-8(13)12-11/h6-7H,11H2,1-5H3,(H,12,13)/b7-6+ |
| InChIKey | QUTVDGRJDHYYQF-VOTSOKGWSA-N |
| XLogP | 1.97 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|