C16H18ClNO2 — CID 14277766
2,3,5-trimethyl-6-(1-pyridin-3-ylethyl)cyclohexa-2,5-diene-1,4-dione;hydrochloride (PubChem CID 14277766) has the molecular formula C16H18ClNO2 and a molecular weight of 291.78 g/mol. Its IUPAC name is 2,3,5-trimethyl-6-(1-pyridin-3-ylethyl)cyclohexa-2,5-diene-1,4-dione;hydrochloride.
| Compound Name | 2,3,5-trimethyl-6-(1-pyridin-3-ylethyl)cyclohexa-2,5-diene-1,4-dione;hydrochloride |
|---|---|
| PubChem CID | 14277766 |
| Molecular Formula | C16H18ClNO2 |
| Molecular Weight | 291.78 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | 2,3,5-trimethyl-6-(1-pyridin-3-ylethyl)cyclohexa-2,5-diene-1,4-dione;hydrochloride |
| SMILES | CC1=C(C)C(=O)C(C(C)c2cccnc2)=C(C)C1=O.Cl |
| InChI | InChI=1S/C16H17NO2.ClH/c1-9-10(2)16(19)14(12(4)15(9)18)11(3)13-6-5-7-17-8-13;/h5-8,11H,1-4H3;1H |
| InChIKey | UIQKZQYPDBJDHW-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.78 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|