C17H20ClNO3 — CID 19043480
3,5-dimethyl-2-[propan-2-yloxy(pyridin-3-yl)methyl]cyclohexa-2,5-diene-1,4-dione;hydrochloride (PubChem CID 19043480) has the molecular formula C17H20ClNO3 and a molecular weight of 321.80 g/mol. Its IUPAC name is 3,5-dimethyl-2-[propan-2-yloxy(pyridin-3-yl)methyl]cyclohexa-2,5-diene-1,4-dione;hydrochloride.
| Compound Name | 3,5-dimethyl-2-[propan-2-yloxy(pyridin-3-yl)methyl]cyclohexa-2,5-diene-1,4-dione;hydrochloride |
|---|---|
| PubChem CID | 19043480 |
| Molecular Formula | C17H20ClNO3 |
| Molecular Weight | 321.80 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 3,5-dimethyl-2-[propan-2-yloxy(pyridin-3-yl)methyl]cyclohexa-2,5-diene-1,4-dione;hydrochloride |
| SMILES | CC1=CC(=O)C(C(OC(C)C)c2cccnc2)=C(C)C1=O.Cl |
| InChI | InChI=1S/C17H19NO3.ClH/c1-10(2)21-17(13-6-5-7-18-9-13)15-12(4)16(20)11(3)8-14(15)19;/h5-10,17H,1-4H3;1H |
| InChIKey | HOLJDAWSQKMJQI-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.80 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|