C21H27NO2 — CID 14277780
2,3,5-trimethyl-6-(1-pyridin-3-ylheptyl)cyclohexa-2,5-diene-1,4-dione (PubChem CID 14277780) has the molecular formula C21H27NO2 and a molecular weight of 325.45 g/mol. Its IUPAC name is 2,3,5-trimethyl-6-(1-pyridin-3-ylheptyl)cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2,3,5-trimethyl-6-(1-pyridin-3-ylheptyl)cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 14277780 |
| Molecular Formula | C21H27NO2 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | 2,3,5-trimethyl-6-(1-pyridin-3-ylheptyl)cyclohexa-2,5-diene-1,4-dione |
| SMILES | CCCCCCC(C1=C(C)C(=O)C(C)=C(C)C1=O)c1cccnc1 |
| InChI | InChI=1S/C21H27NO2/c1-5-6-7-8-11-18(17-10-9-12-22-13-17)19-16(4)20(23)14(2)15(3)21(19)24/h9-10,12-13,18H,5-8,11H2,1-4H3 |
| InChIKey | MHQOLAHBVMQEIB-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|