C32H35Cl3N6O — CID 142778263
2,2-bis[4-[[(5-chloro-2-pyridinyl)amino]methyl]phenyl]-4-propan-2-ylpiperazine-1-carbaldehyde;hydrochloride (PubChem CID 142778263) has the molecular formula C32H35Cl3N6O and a molecular weight of 626.03 g/mol. Its IUPAC name is 2,2-bis[4-[[(5-chloro-2-pyridinyl)amino]methyl]phenyl]-4-propan-2-ylpiperazine-1-carbaldehyde;hydrochloride.
| Compound Name | 2,2-bis[4-[[(5-chloro-2-pyridinyl)amino]methyl]phenyl]-4-propan-2-ylpiperazine-1-carbaldehyde;hydrochloride |
|---|---|
| PubChem CID | 142778263 |
| Molecular Formula | C32H35Cl3N6O |
| Molecular Weight | 626.03 g/mol |
| Exact Mass | 624.19 |
| IUPAC Name | 2,2-bis[4-[[(5-chloro-2-pyridinyl)amino]methyl]phenyl]-4-propan-2-ylpiperazine-1-carbaldehyde;hydrochloride |
| SMILES | CC(C)N1CCN(C=O)C(c2ccc(CNc3ccc(Cl)cn3)cc2)(c2ccc(CNc3ccc(Cl)cn3)cc2)C1.Cl |
| InChI | InChI=1S/C32H34Cl2N6O.ClH/c1-23(2)39-15-16-40(22-41)32(21-39,26-7-3-24(4-8-26)17-35-30-13-11-28(33)19-37-30)27-9-5-25(6-10-27)18-36-31-14-12-29(34)20-38-31;/h3-14,19-20,22-23H,15-18,21H2,1-2H3,(H,35,37)(H,36,38);1H |
| InChIKey | SSZYAQGMKVIOIN-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.03 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|