C7H12N2O4S — CID 142782715
N-morpholin-4-ylsulfonylprop-2-enamide (PubChem CID 142782715) has the molecular formula C7H12N2O4S and a molecular weight of 220.25 g/mol. Its IUPAC name is N-morpholin-4-ylsulfonylprop-2-enamide.
| Compound Name | N-morpholin-4-ylsulfonylprop-2-enamide |
|---|---|
| PubChem CID | 142782715 |
| Molecular Formula | C7H12N2O4S |
| Molecular Weight | 220.25 g/mol |
| Exact Mass | 220.05 |
| IUPAC Name | N-morpholin-4-ylsulfonylprop-2-enamide |
| SMILES | C=CC(=O)NS(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C7H12N2O4S/c1-2-7(10)8-14(11,12)9-3-5-13-6-4-9/h2H,1,3-6H2,(H,8,10) |
| InChIKey | BGSPCDRDPCYVFL-UHFFFAOYSA-N |
| XLogP | -1.13 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.25 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|