C12H25N3O4S — CID 134115048
1-(2,4-dimethylpentan-3-yl)-3-morpholin-4-ylsulfonylurea (PubChem CID 134115048) has the molecular formula C12H25N3O4S and a molecular weight of 307.42 g/mol. Its IUPAC name is 1-(2,4-dimethylpentan-3-yl)-3-morpholin-4-ylsulfonylurea.
| Compound Name | 1-(2,4-dimethylpentan-3-yl)-3-morpholin-4-ylsulfonylurea |
|---|---|
| PubChem CID | 134115048 |
| Molecular Formula | C12H25N3O4S |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | 1-(2,4-dimethylpentan-3-yl)-3-morpholin-4-ylsulfonylurea |
| SMILES | CC(C)C(NC(=O)NS(=O)(=O)N1CCOCC1)C(C)C |
| InChI | InChI=1S/C12H25N3O4S/c1-9(2)11(10(3)4)13-12(16)14-20(17,18)15-5-7-19-8-6-15/h9-11H,5-8H2,1-4H3,(H2,13,14,16) |
| InChIKey | HRARQPVBZFXGSI-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |