C8H18N4O3S — CID 170311112
1-piperazin-1-ylsulfonyl-3-propan-2-ylurea (PubChem CID 170311112) has the molecular formula C8H18N4O3S and a molecular weight of 250.32 g/mol. Its IUPAC name is 1-piperazin-1-ylsulfonyl-3-propan-2-ylurea.
| Compound Name | 1-piperazin-1-ylsulfonyl-3-propan-2-ylurea |
|---|---|
| PubChem CID | 170311112 |
| Molecular Formula | C8H18N4O3S |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 1-piperazin-1-ylsulfonyl-3-propan-2-ylurea |
| SMILES | CC(C)NC(=O)NS(=O)(=O)N1CCNCC1 |
| InChI | InChI=1S/C8H18N4O3S/c1-7(2)10-8(13)11-16(14,15)12-5-3-9-4-6-12/h7,9H,3-6H2,1-2H3,(H2,10,11,13) |
| InChIKey | BNRZAJDYRALTOR-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |