C13H25N3O3S — CID 134126330
1-(1-methylcyclohexyl)-3-piperidin-1-ylsulfonylurea (PubChem CID 134126330) has the molecular formula C13H25N3O3S and a molecular weight of 303.43 g/mol. Its IUPAC name is 1-(1-methylcyclohexyl)-3-piperidin-1-ylsulfonylurea.
| Compound Name | 1-(1-methylcyclohexyl)-3-piperidin-1-ylsulfonylurea |
|---|---|
| PubChem CID | 134126330 |
| Molecular Formula | C13H25N3O3S |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | 1-(1-methylcyclohexyl)-3-piperidin-1-ylsulfonylurea |
| SMILES | CC1(NC(=O)NS(=O)(=O)N2CCCCC2)CCCCC1 |
| InChI | InChI=1S/C13H25N3O3S/c1-13(8-4-2-5-9-13)14-12(17)15-20(18,19)16-10-6-3-7-11-16/h2-11H2,1H3,(H2,14,15,17) |
| InChIKey | KWKHTZGWJZUPEP-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |