C19H34N4O5S2 — CID 134126333
1,3-bis(8-azaspiro[4.5]decan-8-ylsulfonyl)urea (PubChem CID 134126333) has the molecular formula C19H34N4O5S2 and a molecular weight of 462.64 g/mol. Its IUPAC name is 1,3-bis(8-azaspiro[4.5]decan-8-ylsulfonyl)urea.
| Compound Name | 1,3-bis(8-azaspiro[4.5]decan-8-ylsulfonyl)urea |
|---|---|
| PubChem CID | 134126333 |
| Molecular Formula | C19H34N4O5S2 |
| Molecular Weight | 462.64 g/mol |
| Exact Mass | 462.20 |
| IUPAC Name | 1,3-bis(8-azaspiro[4.5]decan-8-ylsulfonyl)urea |
| SMILES | O=C(NS(=O)(=O)N1CCC2(CCCC2)CC1)NS(=O)(=O)N1CCC2(CCCC2)CC1 |
| InChI | InChI=1S/C19H34N4O5S2/c24-17(20-29(25,26)22-13-9-18(10-14-22)5-1-2-6-18)21-30(27,28)23-15-11-19(12-16-23)7-3-4-8-19/h1-16H2,(H2,20,21,24) |
| InChIKey | KUSJCYAKUORLSZ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.64 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |