C17H14Cl2N4O2S — CID 142783722
5-(2-amino-4-methylpyrimidin-5-yl)-2-chloro-3-(4-chlorophenyl)benzenesulfonamide (PubChem CID 142783722) has the molecular formula C17H14Cl2N4O2S and a molecular weight of 409.30 g/mol. Its IUPAC name is 5-(2-amino-4-methylpyrimidin-5-yl)-2-chloro-3-(4-chlorophenyl)benzenesulfonamide.
| Compound Name | 5-(2-amino-4-methylpyrimidin-5-yl)-2-chloro-3-(4-chlorophenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 142783722 |
| Molecular Formula | C17H14Cl2N4O2S |
| Molecular Weight | 409.30 g/mol |
| Exact Mass | 408.02 |
| IUPAC Name | 5-(2-amino-4-methylpyrimidin-5-yl)-2-chloro-3-(4-chlorophenyl)benzenesulfonamide |
| SMILES | Cc1nc(N)ncc1-c1cc(-c2ccc(Cl)cc2)c(Cl)c(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C17H14Cl2N4O2S/c1-9-14(8-22-17(20)23-9)11-6-13(10-2-4-12(18)5-3-10)16(19)15(7-11)26(21,24)25/h2-8H,1H3,(H2,20,22,23)(H2,21,24,25) |
| InChIKey | IYVFUBWIABGUAV-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 111.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.30 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |