C16H20ClN5O2S — CID 142783760
5-(2-amino-4-methylpyrimidin-5-yl)-2-chloro-3-piperidin-4-ylbenzenesulfonamide (PubChem CID 142783760) has the molecular formula C16H20ClN5O2S and a molecular weight of 381.89 g/mol. Its IUPAC name is 5-(2-amino-4-methylpyrimidin-5-yl)-2-chloro-3-piperidin-4-ylbenzenesulfonamide.
| Compound Name | 5-(2-amino-4-methylpyrimidin-5-yl)-2-chloro-3-piperidin-4-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 142783760 |
| Molecular Formula | C16H20ClN5O2S |
| Molecular Weight | 381.89 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | 5-(2-amino-4-methylpyrimidin-5-yl)-2-chloro-3-piperidin-4-ylbenzenesulfonamide |
| SMILES | Cc1nc(N)ncc1-c1cc(C2CCNCC2)c(Cl)c(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C16H20ClN5O2S/c1-9-13(8-21-16(18)22-9)11-6-12(10-2-4-20-5-3-10)15(17)14(7-11)25(19,23)24/h6-8,10,20H,2-5H2,1H3,(H2,18,21,22)(H2,19,23,24) |
| InChIKey | UFLYTYMICMVJHB-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 123.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.89 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |