C13H23NO7S — CID 142785447
1-(2-methylpropoxycarbonylamino)-4-methylsulfonyloxycyclohexane-1-carboxylic acid (PubChem CID 142785447) has the molecular formula C13H23NO7S and a molecular weight of 337.39 g/mol. Its IUPAC name is 1-(2-methylpropoxycarbonylamino)-4-methylsulfonyloxycyclohexane-1-carboxylic acid.
| Compound Name | 1-(2-methylpropoxycarbonylamino)-4-methylsulfonyloxycyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 142785447 |
| Molecular Formula | C13H23NO7S |
| Molecular Weight | 337.39 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | 1-(2-methylpropoxycarbonylamino)-4-methylsulfonyloxycyclohexane-1-carboxylic acid |
| SMILES | CC(C)COC(=O)NC1(C(=O)O)CCC(OS(C)(=O)=O)CC1 |
| InChI | InChI=1S/C13H23NO7S/c1-9(2)8-20-12(17)14-13(11(15)16)6-4-10(5-7-13)21-22(3,18)19/h9-10H,4-8H2,1-3H3,(H,14,17)(H,15,16) |
| InChIKey | VBLIWSZYKOGTPO-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.39 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|