C17H17BN4O4S — CID 142785516
[6-(ethylcarbamoylamino)-4-(4-phenyl-1,3-thiazol-2-yl)-3-pyridinyl]oxyboronic acid (PubChem CID 142785516) has the molecular formula C17H17BN4O4S and a molecular weight of 384.23 g/mol. Its IUPAC name is [6-(ethylcarbamoylamino)-4-(4-phenyl-1,3-thiazol-2-yl)-3-pyridinyl]oxyboronic acid.
| Compound Name | [6-(ethylcarbamoylamino)-4-(4-phenyl-1,3-thiazol-2-yl)-3-pyridinyl]oxyboronic acid |
|---|---|
| PubChem CID | 142785516 |
| Molecular Formula | C17H17BN4O4S |
| Molecular Weight | 384.23 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | [6-(ethylcarbamoylamino)-4-(4-phenyl-1,3-thiazol-2-yl)-3-pyridinyl]oxyboronic acid |
| SMILES | CCNC(=O)Nc1cc(-c2nc(-c3ccccc3)cs2)c(OB(O)O)cn1 |
| InChI | InChI=1S/C17H17BN4O4S/c1-2-19-17(23)22-15-8-12(14(9-20-15)26-18(24)25)16-21-13(10-27-16)11-6-4-3-5-7-11/h3-10,24-25H,2H2,1H3,(H2,19,20,22,23) |
| InChIKey | QFRRAYXMAVERQK-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 116.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.23 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|