C16H16BN5O4S — CID 142785517
[6-(ethylcarbamoylamino)-4-(4-pyridin-2-yl-1,3-thiazol-2-yl)-3-pyridinyl]oxyboronic acid (PubChem CID 142785517) has the molecular formula C16H16BN5O4S and a molecular weight of 385.21 g/mol. Its IUPAC name is [6-(ethylcarbamoylamino)-4-(4-pyridin-2-yl-1,3-thiazol-2-yl)-3-pyridinyl]oxyboronic acid.
| Compound Name | [6-(ethylcarbamoylamino)-4-(4-pyridin-2-yl-1,3-thiazol-2-yl)-3-pyridinyl]oxyboronic acid |
|---|---|
| PubChem CID | 142785517 |
| Molecular Formula | C16H16BN5O4S |
| Molecular Weight | 385.21 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | [6-(ethylcarbamoylamino)-4-(4-pyridin-2-yl-1,3-thiazol-2-yl)-3-pyridinyl]oxyboronic acid |
| SMILES | CCNC(=O)Nc1cc(-c2nc(-c3ccccn3)cs2)c(OB(O)O)cn1 |
| InChI | InChI=1S/C16H16BN5O4S/c1-2-18-16(23)22-14-7-10(13(8-20-14)26-17(24)25)15-21-12(9-27-15)11-5-3-4-6-19-11/h3-9,24-25H,2H2,1H3,(H2,18,20,22,23) |
| InChIKey | KOYPBCWAUNYDKP-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 129.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.21 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|