C20H19FN4O4S — CID 142785931
2-[5-amino-6-(4-fluorobenzoyl)pyrazin-2-yl]-6-(2-methoxyethyl)benzenesulfonamide (PubChem CID 142785931) has the molecular formula C20H19FN4O4S and a molecular weight of 430.46 g/mol. Its IUPAC name is 2-[5-amino-6-(4-fluorobenzoyl)pyrazin-2-yl]-6-(2-methoxyethyl)benzenesulfonamide.
| Compound Name | 2-[5-amino-6-(4-fluorobenzoyl)pyrazin-2-yl]-6-(2-methoxyethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 142785931 |
| Molecular Formula | C20H19FN4O4S |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | 2-[5-amino-6-(4-fluorobenzoyl)pyrazin-2-yl]-6-(2-methoxyethyl)benzenesulfonamide |
| SMILES | COCCc1cccc(-c2cnc(N)c(C(=O)c3ccc(F)cc3)n2)c1S(N)(=O)=O |
| InChI | InChI=1S/C20H19FN4O4S/c1-29-10-9-13-3-2-4-15(19(13)30(23,27)28)16-11-24-20(22)17(25-16)18(26)12-5-7-14(21)8-6-12/h2-8,11H,9-10H2,1H3,(H2,22,24)(H2,23,27,28) |
| InChIKey | GNBXOFAGUZIDKS-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 138.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |