C12H12N4O2 — CID 10377153
3-amino-6-(2-methoxyphenyl)pyrazine-2-carboxamide (PubChem CID 10377153) has the molecular formula C12H12N4O2 and a molecular weight of 244.25 g/mol. Its IUPAC name is 3-amino-6-(2-methoxyphenyl)pyrazine-2-carboxamide.
| Compound Name | 3-amino-6-(2-methoxyphenyl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 10377153 |
| Molecular Formula | C12H12N4O2 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 3-amino-6-(2-methoxyphenyl)pyrazine-2-carboxamide |
| SMILES | COc1ccccc1-c1cnc(N)c(C(N)=O)n1 |
| InChI | InChI=1S/C12H12N4O2/c1-18-9-5-3-2-4-7(9)8-6-15-11(13)10(16-8)12(14)17/h2-6H,1H3,(H2,13,15)(H2,14,17) |
| InChIKey | SIKWZTDTNXXAFU-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 104.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |