C13H13N3O3 — CID 116646649
methyl 4-amino-2-(2-methoxyphenyl)pyrimidine-5-carboxylate (PubChem CID 116646649) has the molecular formula C13H13N3O3 and a molecular weight of 259.27 g/mol. Its IUPAC name is methyl 4-amino-2-(2-methoxyphenyl)pyrimidine-5-carboxylate.
| Compound Name | methyl 4-amino-2-(2-methoxyphenyl)pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 116646649 |
| Molecular Formula | C13H13N3O3 |
| Molecular Weight | 259.27 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | methyl 4-amino-2-(2-methoxyphenyl)pyrimidine-5-carboxylate |
| SMILES | COC(=O)c1cnc(-c2ccccc2OC)nc1N |
| InChI | InChI=1S/C13H13N3O3/c1-18-10-6-4-3-5-8(10)12-15-7-9(11(14)16-12)13(17)19-2/h3-7H,1-2H3,(H2,14,15,16) |
| InChIKey | WOXOEIMFQSTOCG-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 87.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.27 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |