C12H8BrF2N3O2 — CID 107541127
methyl 4-amino-2-(2-bromo-3,4-difluorophenyl)pyrimidine-5-carboxylate (PubChem CID 107541127) has the molecular formula C12H8BrF2N3O2 and a molecular weight of 344.12 g/mol. Its IUPAC name is methyl 4-amino-2-(2-bromo-3,4-difluorophenyl)pyrimidine-5-carboxylate.
| Compound Name | methyl 4-amino-2-(2-bromo-3,4-difluorophenyl)pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 107541127 |
| Molecular Formula | C12H8BrF2N3O2 |
| Molecular Weight | 344.12 g/mol |
| Exact Mass | 342.98 |
| IUPAC Name | methyl 4-amino-2-(2-bromo-3,4-difluorophenyl)pyrimidine-5-carboxylate |
| SMILES | COC(=O)c1cnc(-c2ccc(F)c(F)c2Br)nc1N |
| InChI | InChI=1S/C12H8BrF2N3O2/c1-20-12(19)6-4-17-11(18-10(6)16)5-2-3-7(14)9(15)8(5)13/h2-4H,1H3,(H2,16,17,18) |
| InChIKey | AHAIXBHVQDUJAI-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.12 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|