C13H11BrF2N2O — CID 107540932
1-[2-(2-bromo-3,4-difluorophenyl)-4-methylpyrimidin-5-yl]ethanol (PubChem CID 107540932) has the molecular formula C13H11BrF2N2O and a molecular weight of 329.14 g/mol. Its IUPAC name is 1-[2-(2-bromo-3,4-difluorophenyl)-4-methylpyrimidin-5-yl]ethanol.
| Compound Name | 1-[2-(2-bromo-3,4-difluorophenyl)-4-methylpyrimidin-5-yl]ethanol |
|---|---|
| PubChem CID | 107540932 |
| Molecular Formula | C13H11BrF2N2O |
| Molecular Weight | 329.14 g/mol |
| Exact Mass | 328.00 |
| IUPAC Name | 1-[2-(2-bromo-3,4-difluorophenyl)-4-methylpyrimidin-5-yl]ethanol |
| SMILES | Cc1nc(-c2ccc(F)c(F)c2Br)ncc1C(C)O |
| InChI | InChI=1S/C13H11BrF2N2O/c1-6-9(7(2)19)5-17-13(18-6)8-3-4-10(15)12(16)11(8)14/h3-5,7,19H,1-2H3 |
| InChIKey | HHOPXHAXYDLREZ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.14 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|