C10H3Br3F2N2 — CID 107537902
4,6-dibromo-2-(2-bromo-3,4-difluorophenyl)pyrimidine (PubChem CID 107537902) has the molecular formula C10H3Br3F2N2 and a molecular weight of 428.86 g/mol. Its IUPAC name is 4,6-dibromo-2-(2-bromo-3,4-difluorophenyl)pyrimidine.
| Compound Name | 4,6-dibromo-2-(2-bromo-3,4-difluorophenyl)pyrimidine |
|---|---|
| PubChem CID | 107537902 |
| Molecular Formula | C10H3Br3F2N2 |
| Molecular Weight | 428.86 g/mol |
| Exact Mass | 425.78 |
| IUPAC Name | 4,6-dibromo-2-(2-bromo-3,4-difluorophenyl)pyrimidine |
| SMILES | Fc1ccc(-c2nc(Br)cc(Br)n2)c(Br)c1F |
| InChI | InChI=1S/C10H3Br3F2N2/c11-6-3-7(12)17-10(16-6)4-1-2-5(14)9(15)8(4)13/h1-3H |
| InChIKey | TXEIGNAIXNWPGO-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.86 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|