C12H9BrF2IN3 — CID 107539759
2-(2-bromo-3,4-difluorophenyl)-6-ethyl-5-iodopyrimidin-4-amine (PubChem CID 107539759) has the molecular formula C12H9BrF2IN3 and a molecular weight of 440.03 g/mol. Its IUPAC name is 2-(2-bromo-3,4-difluorophenyl)-6-ethyl-5-iodopyrimidin-4-amine.
| Compound Name | 2-(2-bromo-3,4-difluorophenyl)-6-ethyl-5-iodopyrimidin-4-amine |
|---|---|
| PubChem CID | 107539759 |
| Molecular Formula | C12H9BrF2IN3 |
| Molecular Weight | 440.03 g/mol |
| Exact Mass | 438.90 |
| IUPAC Name | 2-(2-bromo-3,4-difluorophenyl)-6-ethyl-5-iodopyrimidin-4-amine |
| SMILES | CCc1nc(-c2ccc(F)c(F)c2Br)nc(N)c1I |
| InChI | InChI=1S/C12H9BrF2IN3/c1-2-7-10(16)11(17)19-12(18-7)5-3-4-6(14)9(15)8(5)13/h3-4H,2H2,1H3,(H2,17,18,19) |
| InChIKey | QIZHYRKOFKETSK-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.03 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|