C12H8BrF2N3S — CID 107539786
2-(2-bromo-3,4-difluorophenyl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-amine (PubChem CID 107539786) has the molecular formula C12H8BrF2N3S and a molecular weight of 344.18 g/mol. Its IUPAC name is 2-(2-bromo-3,4-difluorophenyl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-amine.
| Compound Name | 2-(2-bromo-3,4-difluorophenyl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 107539786 |
| Molecular Formula | C12H8BrF2N3S |
| Molecular Weight | 344.18 g/mol |
| Exact Mass | 342.96 |
| IUPAC Name | 2-(2-bromo-3,4-difluorophenyl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-amine |
| SMILES | Nc1nc(-c2ccc(F)c(F)c2Br)nc2c1CSC2 |
| InChI | InChI=1S/C12H8BrF2N3S/c13-9-5(1-2-7(14)10(9)15)12-17-8-4-19-3-6(8)11(16)18-12/h1-2H,3-4H2,(H2,16,17,18) |
| InChIKey | SXRSJZLCORHVGR-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.18 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|